C41H35F5N4O6S — CID 175342552
benzyl 4-[(5-cyclopentylpyrazin-2-yl)methyl-[(2R)-1-(2,3,4,5,6-pentafluorophenyl)sulfonyl-2-phenylmethoxyazetidine-2-carbonyl]amino]benzoate (PubChem CID 175342552) has the molecular formula C41H35F5N4O6S and a molecular weight of 806.81 g/mol. Its IUPAC name is benzyl 4-[(5-cyclopentylpyrazin-2-yl)methyl-[(2R)-1-(2,3,4,5,6-pentafluorophenyl)sulfonyl-2-phenylmethoxyazetidine-2-carbonyl]amino]benzoate.
| Compound Name | benzyl 4-[(5-cyclopentylpyrazin-2-yl)methyl-[(2R)-1-(2,3,4,5,6-pentafluorophenyl)sulfonyl-2-phenylmethoxyazetidine-2-carbonyl]amino]benzoate |
|---|---|
| PubChem CID | 175342552 |
| Molecular Formula | C41H35F5N4O6S |
| Molecular Weight | 806.81 g/mol |
| Exact Mass | 806.22 |
| IUPAC Name | benzyl 4-[(5-cyclopentylpyrazin-2-yl)methyl-[(2R)-1-(2,3,4,5,6-pentafluorophenyl)sulfonyl-2-phenylmethoxyazetidine-2-carbonyl]amino]benzoate |
| SMILES | O=C(OCc1ccccc1)c1ccc(N(Cc2cnc(C3CCCC3)cn2)C(=O)[C@]2(OCc3ccccc3)CCN2S(=O)(=O)c2c(F)c(F)c(F)c(F)c2F)cc1 |
| InChI | InChI=1S/C41H35F5N4O6S/c42-33-34(43)36(45)38(37(46)35(33)44)57(53,54)50-20-19-41(50,56-25-27-11-5-2-6-12-27)40(52)49(23-30-21-48-32(22-47-30)28-13-7-8-14-28)31-17-15-29(16-18-31)39(51)55-24-26-9-3-1-4-10-26/h1-6,9-12,15-18,21-22,28H,7-8,13-14,19-20,23-25H2/t41-/m1/s1 |
| InChIKey | NSCWCCDHSBQRIC-VQJSHJPSSA-N |
| XLogP | 7.73 |
| TPSA | 119.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 806.81 |
| LogP ≤ 5 | 7.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|