C36H27F5N2O7S — CID 175040498
4-[[4-(furan-3-yl)phenyl]methyl-[(2R)-1-(2,3,4,5,6-pentafluorophenyl)sulfonyl-2-phenylmethoxypyrrolidine-2-carbonyl]amino]benzoic acid (PubChem CID 175040498) has the molecular formula C36H27F5N2O7S and a molecular weight of 726.68 g/mol. Its IUPAC name is 4-[[4-(furan-3-yl)phenyl]methyl-[(2R)-1-(2,3,4,5,6-pentafluorophenyl)sulfonyl-2-phenylmethoxypyrrolidine-2-carbonyl]amino]benzoic acid.
| Compound Name | 4-[[4-(furan-3-yl)phenyl]methyl-[(2R)-1-(2,3,4,5,6-pentafluorophenyl)sulfonyl-2-phenylmethoxypyrrolidine-2-carbonyl]amino]benzoic acid |
|---|---|
| PubChem CID | 175040498 |
| Molecular Formula | C36H27F5N2O7S |
| Molecular Weight | 726.68 g/mol |
| Exact Mass | 726.15 |
| IUPAC Name | 4-[[4-(furan-3-yl)phenyl]methyl-[(2R)-1-(2,3,4,5,6-pentafluorophenyl)sulfonyl-2-phenylmethoxypyrrolidine-2-carbonyl]amino]benzoic acid |
| SMILES | O=C(O)c1ccc(N(Cc2ccc(-c3ccoc3)cc2)C(=O)[C@]2(OCc3ccccc3)CCCN2S(=O)(=O)c2c(F)c(F)c(F)c(F)c2F)cc1 |
| InChI | InChI=1S/C36H27F5N2O7S/c37-28-29(38)31(40)33(32(41)30(28)39)51(47,48)43-17-4-16-36(43,50-20-23-5-2-1-3-6-23)35(46)42(27-13-11-25(12-14-27)34(44)45)19-22-7-9-24(10-8-22)26-15-18-49-21-26/h1-3,5-15,18,21H,4,16-17,19-20H2,(H,44,45)/t36-/m1/s1 |
| InChIKey | VVKUKZCZQYTLDQ-PSXMRANNSA-N |
| XLogP | 7.27 |
| TPSA | 117.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 726.68 |
| LogP ≤ 5 | 7.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|