C29H25F5N2O7S — CID 175343505
4-[[(2R)-2-hydroxy-1-(2,3,4,5,6-pentafluorophenyl)sulfonylazetidine-2-carbonyl]-[[4-(oxan-4-yl)phenyl]methyl]amino]benzoic acid (PubChem CID 175343505) has the molecular formula C29H25F5N2O7S and a molecular weight of 640.58 g/mol. Its IUPAC name is 4-[[(2R)-2-hydroxy-1-(2,3,4,5,6-pentafluorophenyl)sulfonylazetidine-2-carbonyl]-[[4-(oxan-4-yl)phenyl]methyl]amino]benzoic acid.
| Compound Name | 4-[[(2R)-2-hydroxy-1-(2,3,4,5,6-pentafluorophenyl)sulfonylazetidine-2-carbonyl]-[[4-(oxan-4-yl)phenyl]methyl]amino]benzoic acid |
|---|---|
| PubChem CID | 175343505 |
| Molecular Formula | C29H25F5N2O7S |
| Molecular Weight | 640.58 g/mol |
| Exact Mass | 640.13 |
| IUPAC Name | 4-[[(2R)-2-hydroxy-1-(2,3,4,5,6-pentafluorophenyl)sulfonylazetidine-2-carbonyl]-[[4-(oxan-4-yl)phenyl]methyl]amino]benzoic acid |
| SMILES | O=C(O)c1ccc(N(Cc2ccc(C3CCOCC3)cc2)C(=O)[C@]2(O)CCN2S(=O)(=O)c2c(F)c(F)c(F)c(F)c2F)cc1 |
| InChI | InChI=1S/C29H25F5N2O7S/c30-21-22(31)24(33)26(25(34)23(21)32)44(41,42)36-12-11-29(36,40)28(39)35(20-7-5-19(6-8-20)27(37)38)15-16-1-3-17(4-2-16)18-9-13-43-14-10-18/h1-8,18,40H,9-15H2,(H,37,38)/t29-/m1/s1 |
| InChIKey | QCTLPVFKQNXIIC-GDLZYMKVSA-N |
| XLogP | 4.29 |
| TPSA | 124.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 640.58 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|