C46H43F5N2O6S — CID 175038901
benzyl 4-[(4-cyclohexylphenyl)methyl-[(2R)-1-(2,3,4,5,6-pentafluorophenyl)sulfonyl-2-phenylmethoxypiperidine-2-carbonyl]amino]benzoate (PubChem CID 175038901) has the molecular formula C46H43F5N2O6S and a molecular weight of 846.92 g/mol. Its IUPAC name is benzyl 4-[(4-cyclohexylphenyl)methyl-[(2R)-1-(2,3,4,5,6-pentafluorophenyl)sulfonyl-2-phenylmethoxypiperidine-2-carbonyl]amino]benzoate.
| Compound Name | benzyl 4-[(4-cyclohexylphenyl)methyl-[(2R)-1-(2,3,4,5,6-pentafluorophenyl)sulfonyl-2-phenylmethoxypiperidine-2-carbonyl]amino]benzoate |
|---|---|
| PubChem CID | 175038901 |
| Molecular Formula | C46H43F5N2O6S |
| Molecular Weight | 846.92 g/mol |
| Exact Mass | 846.28 |
| IUPAC Name | benzyl 4-[(4-cyclohexylphenyl)methyl-[(2R)-1-(2,3,4,5,6-pentafluorophenyl)sulfonyl-2-phenylmethoxypiperidine-2-carbonyl]amino]benzoate |
| SMILES | O=C(OCc1ccccc1)c1ccc(N(Cc2ccc(C3CCCCC3)cc2)C(=O)[C@]2(OCc3ccccc3)CCCCN2S(=O)(=O)c2c(F)c(F)c(F)c(F)c2F)cc1 |
| InChI | InChI=1S/C46H43F5N2O6S/c47-38-39(48)41(50)43(42(51)40(38)49)60(56,57)53-27-11-10-26-46(53,59-30-33-14-6-2-7-15-33)45(55)52(28-31-18-20-35(21-19-31)34-16-8-3-9-17-34)37-24-22-36(23-25-37)44(54)58-29-32-12-4-1-5-13-32/h1-2,4-7,12-15,18-25,34H,3,8-11,16-17,26-30H2/t46-/m1/s1 |
| InChIKey | YXWNRQMTCBIPMP-YACUFSJGSA-N |
| XLogP | 10.11 |
| TPSA | 93.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 60 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 846.92 |
| LogP ≤ 5 | 10.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|