C30H21BrF5N3O6S — CID 175041874
4-[(5-bromo-2-pyridinyl)methyl-[(2R)-1-(2,3,4,5,6-pentafluorophenyl)sulfonyl-2-phenylmethoxyazetidine-2-carbonyl]amino]benzoic acid (PubChem CID 175041874) has the molecular formula C30H21BrF5N3O6S and a molecular weight of 726.47 g/mol. Its IUPAC name is 4-[(5-bromo-2-pyridinyl)methyl-[(2R)-1-(2,3,4,5,6-pentafluorophenyl)sulfonyl-2-phenylmethoxyazetidine-2-carbonyl]amino]benzoic acid.
| Compound Name | 4-[(5-bromo-2-pyridinyl)methyl-[(2R)-1-(2,3,4,5,6-pentafluorophenyl)sulfonyl-2-phenylmethoxyazetidine-2-carbonyl]amino]benzoic acid |
|---|---|
| PubChem CID | 175041874 |
| Molecular Formula | C30H21BrF5N3O6S |
| Molecular Weight | 726.47 g/mol |
| Exact Mass | 725.03 |
| IUPAC Name | 4-[(5-bromo-2-pyridinyl)methyl-[(2R)-1-(2,3,4,5,6-pentafluorophenyl)sulfonyl-2-phenylmethoxyazetidine-2-carbonyl]amino]benzoic acid |
| SMILES | O=C(O)c1ccc(N(Cc2ccc(Br)cn2)C(=O)[C@]2(OCc3ccccc3)CCN2S(=O)(=O)c2c(F)c(F)c(F)c(F)c2F)cc1 |
| InChI | InChI=1S/C30H21BrF5N3O6S/c31-19-8-9-20(37-14-19)15-38(21-10-6-18(7-11-21)28(40)41)29(42)30(45-16-17-4-2-1-3-5-17)12-13-39(30)46(43,44)27-25(35)23(33)22(32)24(34)26(27)36/h1-11,14H,12-13,15-16H2,(H,40,41)/t30-/m1/s1 |
| InChIKey | BCSVFGKHHAPAQE-SSEXGKCCSA-N |
| XLogP | 5.78 |
| TPSA | 117.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 726.47 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|