C42H37F5N2O6S — CID 175038903
benzyl 4-[(4-tert-butylphenyl)methyl-[(2R)-1-(2,3,4,5,6-pentafluorophenyl)sulfonyl-2-phenylmethoxyazetidine-2-carbonyl]amino]benzoate (PubChem CID 175038903) has the molecular formula C42H37F5N2O6S and a molecular weight of 792.82 g/mol. Its IUPAC name is benzyl 4-[(4-tert-butylphenyl)methyl-[(2R)-1-(2,3,4,5,6-pentafluorophenyl)sulfonyl-2-phenylmethoxyazetidine-2-carbonyl]amino]benzoate.
| Compound Name | benzyl 4-[(4-tert-butylphenyl)methyl-[(2R)-1-(2,3,4,5,6-pentafluorophenyl)sulfonyl-2-phenylmethoxyazetidine-2-carbonyl]amino]benzoate |
|---|---|
| PubChem CID | 175038903 |
| Molecular Formula | C42H37F5N2O6S |
| Molecular Weight | 792.82 g/mol |
| Exact Mass | 792.23 |
| IUPAC Name | benzyl 4-[(4-tert-butylphenyl)methyl-[(2R)-1-(2,3,4,5,6-pentafluorophenyl)sulfonyl-2-phenylmethoxyazetidine-2-carbonyl]amino]benzoate |
| SMILES | CC(C)(C)c1ccc(CN(C(=O)[C@]2(OCc3ccccc3)CCN2S(=O)(=O)c2c(F)c(F)c(F)c(F)c2F)c2ccc(C(=O)OCc3ccccc3)cc2)cc1 |
| InChI | InChI=1S/C42H37F5N2O6S/c1-41(2,3)31-18-14-27(15-19-31)24-48(32-20-16-30(17-21-32)39(50)54-25-28-10-6-4-7-11-28)40(51)42(55-26-29-12-8-5-9-13-29)22-23-49(42)56(52,53)38-36(46)34(44)33(43)35(45)37(38)47/h4-21H,22-26H2,1-3H3/t42-/m1/s1 |
| InChIKey | QCQUYFDNBDOPOX-HUESYALOSA-N |
| XLogP | 8.58 |
| TPSA | 93.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 792.82 |
| LogP ≤ 5 | 8.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|