C12H15Br2NO5S — CID 21210207
4-(2,3-dibromo-5,6-dimethoxyphenyl)sulfonylmorpholine (PubChem CID 21210207) has the molecular formula C12H15Br2NO5S and a molecular weight of 445.13 g/mol. Its IUPAC name is 4-(2,3-dibromo-5,6-dimethoxyphenyl)sulfonylmorpholine.
| Compound Name | 4-(2,3-dibromo-5,6-dimethoxyphenyl)sulfonylmorpholine |
|---|---|
| PubChem CID | 21210207 |
| Molecular Formula | C12H15Br2NO5S |
| Molecular Weight | 445.13 g/mol |
| Exact Mass | 442.90 |
| IUPAC Name | 4-(2,3-dibromo-5,6-dimethoxyphenyl)sulfonylmorpholine |
| SMILES | COc1cc(Br)c(Br)c(S(=O)(=O)N2CCOCC2)c1OC |
| InChI | InChI=1S/C12H15Br2NO5S/c1-18-9-7-8(13)10(14)12(11(9)19-2)21(16,17)15-3-5-20-6-4-15/h7H,3-6H2,1-2H3 |
| InChIKey | AHFDLFGSZXVLMN-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.13 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |