C13H18BrNO3S — CID 7731309
4-(3-bromo-2,4,6-trimethylphenyl)sulfonylmorpholine (PubChem CID 7731309) has the molecular formula C13H18BrNO3S and a molecular weight of 348.26 g/mol. Its IUPAC name is 4-(3-bromo-2,4,6-trimethylphenyl)sulfonylmorpholine.
| Compound Name | 4-(3-bromo-2,4,6-trimethylphenyl)sulfonylmorpholine |
|---|---|
| PubChem CID | 7731309 |
| Molecular Formula | C13H18BrNO3S |
| Molecular Weight | 348.26 g/mol |
| Exact Mass | 347.02 |
| IUPAC Name | 4-(3-bromo-2,4,6-trimethylphenyl)sulfonylmorpholine |
| SMILES | Cc1cc(C)c(S(=O)(=O)N2CCOCC2)c(C)c1Br |
| InChI | InChI=1S/C13H18BrNO3S/c1-9-8-10(2)13(11(3)12(9)14)19(16,17)15-4-6-18-7-5-15/h8H,4-7H2,1-3H3 |
| InChIKey | LKMGLAQFCGSMRW-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.26 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |