C19H22BrFN2O2S — CID 1184063
1-(3-bromo-2,4,6-trimethylphenyl)sulfonyl-4-(4-fluorophenyl)piperazine (PubChem CID 1184063) has the molecular formula C19H22BrFN2O2S and a molecular weight of 441.37 g/mol. Its IUPAC name is 1-(3-bromo-2,4,6-trimethylphenyl)sulfonyl-4-(4-fluorophenyl)piperazine.
| Compound Name | 1-(3-bromo-2,4,6-trimethylphenyl)sulfonyl-4-(4-fluorophenyl)piperazine |
|---|---|
| PubChem CID | 1184063 |
| Molecular Formula | C19H22BrFN2O2S |
| Molecular Weight | 441.37 g/mol |
| Exact Mass | 440.06 |
| IUPAC Name | 1-(3-bromo-2,4,6-trimethylphenyl)sulfonyl-4-(4-fluorophenyl)piperazine |
| SMILES | Cc1cc(C)c(S(=O)(=O)N2CCN(c3ccc(F)cc3)CC2)c(C)c1Br |
| InChI | InChI=1S/C19H22BrFN2O2S/c1-13-12-14(2)19(15(3)18(13)20)26(24,25)23-10-8-22(9-11-23)17-6-4-16(21)5-7-17/h4-7,12H,8-11H2,1-3H3 |
| InChIKey | PYZJFFHQCPLHKV-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.37 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |