C18H20BrFN2O2S — CID 1184061
1-(4-bromo-2,5-dimethylphenyl)sulfonyl-4-(4-fluorophenyl)piperazine (PubChem CID 1184061) has the molecular formula C18H20BrFN2O2S and a molecular weight of 427.34 g/mol. Its IUPAC name is 1-(4-bromo-2,5-dimethylphenyl)sulfonyl-4-(4-fluorophenyl)piperazine.
| Compound Name | 1-(4-bromo-2,5-dimethylphenyl)sulfonyl-4-(4-fluorophenyl)piperazine |
|---|---|
| PubChem CID | 1184061 |
| Molecular Formula | C18H20BrFN2O2S |
| Molecular Weight | 427.34 g/mol |
| Exact Mass | 426.04 |
| IUPAC Name | 1-(4-bromo-2,5-dimethylphenyl)sulfonyl-4-(4-fluorophenyl)piperazine |
| SMILES | Cc1cc(S(=O)(=O)N2CCN(c3ccc(F)cc3)CC2)c(C)cc1Br |
| InChI | InChI=1S/C18H20BrFN2O2S/c1-13-12-18(14(2)11-17(13)19)25(23,24)22-9-7-21(8-10-22)16-5-3-15(20)4-6-16/h3-6,11-12H,7-10H2,1-2H3 |
| InChIKey | WJBURYKYWFKKEE-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.34 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |