C14H15F4NO2 — CID 2989142
4-[3-(2,3,5,6-tetrafluoro-4-methoxyphenyl)prop-2-enyl]morpholine (PubChem CID 2989142) has the molecular formula C14H15F4NO2 and a molecular weight of 305.27 g/mol. Its IUPAC name is 4-[3-(2,3,5,6-tetrafluoro-4-methoxyphenyl)prop-2-enyl]morpholine.
| Compound Name | 4-[3-(2,3,5,6-tetrafluoro-4-methoxyphenyl)prop-2-enyl]morpholine |
|---|---|
| PubChem CID | 2989142 |
| Molecular Formula | C14H15F4NO2 |
| Molecular Weight | 305.27 g/mol |
| Exact Mass | 305.10 |
| IUPAC Name | 4-[3-(2,3,5,6-tetrafluoro-4-methoxyphenyl)prop-2-enyl]morpholine |
| SMILES | COc1c(F)c(F)c(C=CCN2CCOCC2)c(F)c1F |
| InChI | InChI=1S/C14H15F4NO2/c1-20-14-12(17)10(15)9(11(16)13(14)18)3-2-4-19-5-7-21-8-6-19/h2-3H,4-8H2,1H3 |
| InChIKey | QGPIUSNXBQGGGL-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.27 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|