C19H24F4N2O — CID 1301333
4-[(E)-3-[4-(azepan-1-yl)-2,3,5,6-tetrafluorophenyl]prop-2-enyl]morpholine (PubChem CID 1301333) has the molecular formula C19H24F4N2O and a molecular weight of 372.41 g/mol. Its IUPAC name is 4-[(E)-3-[4-(azepan-1-yl)-2,3,5,6-tetrafluorophenyl]prop-2-enyl]morpholine.
| Compound Name | 4-[(E)-3-[4-(azepan-1-yl)-2,3,5,6-tetrafluorophenyl]prop-2-enyl]morpholine |
|---|---|
| PubChem CID | 1301333 |
| Molecular Formula | C19H24F4N2O |
| Molecular Weight | 372.41 g/mol |
| Exact Mass | 372.18 |
| IUPAC Name | 4-[(E)-3-[4-(azepan-1-yl)-2,3,5,6-tetrafluorophenyl]prop-2-enyl]morpholine |
| SMILES | Fc1c(F)c(N2CCCCCC2)c(F)c(F)c1/C=C/CN1CCOCC1 |
| InChI | InChI=1S/C19H24F4N2O/c20-15-14(6-5-7-24-10-12-26-13-11-24)16(21)18(23)19(17(15)22)25-8-3-1-2-4-9-25/h5-6H,1-4,7-13H2/b6-5+ |
| InChIKey | HLCWDSCDVKKBSJ-AATRIKPKSA-N |
| XLogP | 3.97 |
| TPSA | 15.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.41 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|