C20H20F4N2O — CID 2961470
N-benzyl-2,3,5,6-tetrafluoro-4-(3-morpholin-4-ylprop-1-enyl)aniline (PubChem CID 2961470) has the molecular formula C20H20F4N2O and a molecular weight of 380.39 g/mol. Its IUPAC name is N-benzyl-2,3,5,6-tetrafluoro-4-(3-morpholin-4-ylprop-1-enyl)aniline.
| Compound Name | N-benzyl-2,3,5,6-tetrafluoro-4-(3-morpholin-4-ylprop-1-enyl)aniline |
|---|---|
| PubChem CID | 2961470 |
| Molecular Formula | C20H20F4N2O |
| Molecular Weight | 380.39 g/mol |
| Exact Mass | 380.15 |
| IUPAC Name | N-benzyl-2,3,5,6-tetrafluoro-4-(3-morpholin-4-ylprop-1-enyl)aniline |
| SMILES | Fc1c(F)c(NCc2ccccc2)c(F)c(F)c1C=CCN1CCOCC1 |
| InChI | InChI=1S/C20H20F4N2O/c21-16-15(7-4-8-26-9-11-27-12-10-26)17(22)19(24)20(18(16)23)25-13-14-5-2-1-3-6-14/h1-7,25H,8-13H2 |
| InChIKey | PHOPMHXXAMKWOF-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.39 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|