C16H20ClF4NO2 — CID 2990923
4-[3-(2,3,5,6-tetrafluoro-4-propoxyphenyl)prop-2-enyl]morpholine;hydrochloride (PubChem CID 2990923) has the molecular formula C16H20ClF4NO2 and a molecular weight of 369.79 g/mol. Its IUPAC name is 4-[3-(2,3,5,6-tetrafluoro-4-propoxyphenyl)prop-2-enyl]morpholine;hydrochloride.
| Compound Name | 4-[3-(2,3,5,6-tetrafluoro-4-propoxyphenyl)prop-2-enyl]morpholine;hydrochloride |
|---|---|
| PubChem CID | 2990923 |
| Molecular Formula | C16H20ClF4NO2 |
| Molecular Weight | 369.79 g/mol |
| Exact Mass | 369.11 |
| IUPAC Name | 4-[3-(2,3,5,6-tetrafluoro-4-propoxyphenyl)prop-2-enyl]morpholine;hydrochloride |
| SMILES | CCCOc1c(F)c(F)c(C=CCN2CCOCC2)c(F)c1F.Cl |
| InChI | InChI=1S/C16H19F4NO2.ClH/c1-2-8-23-16-14(19)12(17)11(13(18)15(16)20)4-3-5-21-6-9-22-10-7-21;/h3-4H,2,5-10H2,1H3;1H |
| InChIKey | XCNRUWAJPCBNNG-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.79 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|