C22H21F4NO3 — CID 2985362
1-[4-[2,3,5,6-tetrafluoro-4-(3-morpholin-4-ylprop-1-enyl)phenoxy]phenyl]propan-1-one (PubChem CID 2985362) has the molecular formula C22H21F4NO3 and a molecular weight of 423.41 g/mol. Its IUPAC name is 1-[4-[2,3,5,6-tetrafluoro-4-(3-morpholin-4-ylprop-1-enyl)phenoxy]phenyl]propan-1-one.
| Compound Name | 1-[4-[2,3,5,6-tetrafluoro-4-(3-morpholin-4-ylprop-1-enyl)phenoxy]phenyl]propan-1-one |
|---|---|
| PubChem CID | 2985362 |
| Molecular Formula | C22H21F4NO3 |
| Molecular Weight | 423.41 g/mol |
| Exact Mass | 423.15 |
| IUPAC Name | 1-[4-[2,3,5,6-tetrafluoro-4-(3-morpholin-4-ylprop-1-enyl)phenoxy]phenyl]propan-1-one |
| SMILES | CCC(=O)c1ccc(Oc2c(F)c(F)c(C=CCN3CCOCC3)c(F)c2F)cc1 |
| InChI | InChI=1S/C22H21F4NO3/c1-2-17(28)14-5-7-15(8-6-14)30-22-20(25)18(23)16(19(24)21(22)26)4-3-9-27-10-12-29-13-11-27/h3-8H,2,9-13H2,1H3 |
| InChIKey | GWOQRPXMYLGCPX-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.41 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|