C17H24BrClN2O4S — CID 55735041
4-[[1-(3-bromo-5-chloro-2-methoxyphenyl)sulfonylpiperidin-4-yl]methyl]morpholine (PubChem CID 55735041) has the molecular formula C17H24BrClN2O4S and a molecular weight of 467.81 g/mol. Its IUPAC name is 4-[[1-(3-bromo-5-chloro-2-methoxyphenyl)sulfonylpiperidin-4-yl]methyl]morpholine.
| Compound Name | 4-[[1-(3-bromo-5-chloro-2-methoxyphenyl)sulfonylpiperidin-4-yl]methyl]morpholine |
|---|---|
| PubChem CID | 55735041 |
| Molecular Formula | C17H24BrClN2O4S |
| Molecular Weight | 467.81 g/mol |
| Exact Mass | 466.03 |
| IUPAC Name | 4-[[1-(3-bromo-5-chloro-2-methoxyphenyl)sulfonylpiperidin-4-yl]methyl]morpholine |
| SMILES | COc1c(Br)cc(Cl)cc1S(=O)(=O)N1CCC(CN2CCOCC2)CC1 |
| InChI | InChI=1S/C17H24BrClN2O4S/c1-24-17-15(18)10-14(19)11-16(17)26(22,23)21-4-2-13(3-5-21)12-20-6-8-25-9-7-20/h10-11,13H,2-9,12H2,1H3 |
| InChIKey | AMQJOAKHIXZTSW-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.81 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |