C11H12ClNO3S — CID 3291316
1-(5-chloro-2-methoxyphenyl)sulfonyl-2,5-dihydropyrrole (PubChem CID 3291316) has the molecular formula C11H12ClNO3S and a molecular weight of 273.74 g/mol. Its IUPAC name is 1-(5-chloro-2-methoxyphenyl)sulfonyl-2,5-dihydropyrrole.
| Compound Name | 1-(5-chloro-2-methoxyphenyl)sulfonyl-2,5-dihydropyrrole |
|---|---|
| PubChem CID | 3291316 |
| Molecular Formula | C11H12ClNO3S |
| Molecular Weight | 273.74 g/mol |
| Exact Mass | 273.02 |
| IUPAC Name | 1-(5-chloro-2-methoxyphenyl)sulfonyl-2,5-dihydropyrrole |
| SMILES | COc1ccc(Cl)cc1S(=O)(=O)N1CC=CC1 |
| InChI | InChI=1S/C11H12ClNO3S/c1-16-10-5-4-9(12)8-11(10)17(14,15)13-6-2-3-7-13/h2-5,8H,6-7H2,1H3 |
| InChIKey | YCBOWXWUHSSPLH-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.74 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|