C15H22ClNO5S2 — CID 97427292
(3R)-3-tert-butylsulfonyl-1-(5-chloro-2-methoxyphenyl)sulfonylpyrrolidine (PubChem CID 97427292) has the molecular formula C15H22ClNO5S2 and a molecular weight of 395.93 g/mol. Its IUPAC name is (3R)-3-tert-butylsulfonyl-1-(5-chloro-2-methoxyphenyl)sulfonylpyrrolidine.
| Compound Name | (3R)-3-tert-butylsulfonyl-1-(5-chloro-2-methoxyphenyl)sulfonylpyrrolidine |
|---|---|
| PubChem CID | 97427292 |
| Molecular Formula | C15H22ClNO5S2 |
| Molecular Weight | 395.93 g/mol |
| Exact Mass | 395.06 |
| IUPAC Name | (3R)-3-tert-butylsulfonyl-1-(5-chloro-2-methoxyphenyl)sulfonylpyrrolidine |
| SMILES | COc1ccc(Cl)cc1S(=O)(=O)N1CC[C@@H](S(=O)(=O)C(C)(C)C)C1 |
| InChI | InChI=1S/C15H22ClNO5S2/c1-15(2,3)23(18,19)12-7-8-17(10-12)24(20,21)14-9-11(16)5-6-13(14)22-4/h5-6,9,12H,7-8,10H2,1-4H3/t12-/m1/s1 |
| InChIKey | ZCTOVZWQOYSDCD-GFCCVEGCSA-N |
| XLogP | 2.32 |
| TPSA | 80.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.93 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |