C19H22ClNO3S — CID 121146270
1-(5-chloro-2-methoxyphenyl)sulfonyl-3-phenylazepane (PubChem CID 121146270) has the molecular formula C19H22ClNO3S and a molecular weight of 379.91 g/mol. Its IUPAC name is 1-(5-chloro-2-methoxyphenyl)sulfonyl-3-phenylazepane.
| Compound Name | 1-(5-chloro-2-methoxyphenyl)sulfonyl-3-phenylazepane |
|---|---|
| PubChem CID | 121146270 |
| Molecular Formula | C19H22ClNO3S |
| Molecular Weight | 379.91 g/mol |
| Exact Mass | 379.10 |
| IUPAC Name | 1-(5-chloro-2-methoxyphenyl)sulfonyl-3-phenylazepane |
| SMILES | COc1ccc(Cl)cc1S(=O)(=O)N1CCCCC(c2ccccc2)C1 |
| InChI | InChI=1S/C19H22ClNO3S/c1-24-18-11-10-17(20)13-19(18)25(22,23)21-12-6-5-9-16(14-21)15-7-3-2-4-8-15/h2-4,7-8,10-11,13,16H,5-6,9,12,14H2,1H3 |
| InChIKey | XWGYFULUJRNJQO-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.91 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |