C13H15ClN4O3S — CID 124892345
2-[(3R)-1-(5-chloro-2-methoxyphenyl)sulfonylpyrrolidin-3-yl]triazole (PubChem CID 124892345) has the molecular formula C13H15ClN4O3S and a molecular weight of 342.81 g/mol. Its IUPAC name is 2-[(3R)-1-(5-chloro-2-methoxyphenyl)sulfonylpyrrolidin-3-yl]triazole.
| Compound Name | 2-[(3R)-1-(5-chloro-2-methoxyphenyl)sulfonylpyrrolidin-3-yl]triazole |
|---|---|
| PubChem CID | 124892345 |
| Molecular Formula | C13H15ClN4O3S |
| Molecular Weight | 342.81 g/mol |
| Exact Mass | 342.06 |
| IUPAC Name | 2-[(3R)-1-(5-chloro-2-methoxyphenyl)sulfonylpyrrolidin-3-yl]triazole |
| SMILES | COc1ccc(Cl)cc1S(=O)(=O)N1CC[C@@H](n2nccn2)C1 |
| InChI | InChI=1S/C13H15ClN4O3S/c1-21-12-3-2-10(14)8-13(12)22(19,20)17-7-4-11(9-17)18-15-5-6-16-18/h2-3,5-6,8,11H,4,7,9H2,1H3/t11-/m1/s1 |
| InChIKey | QJBBMDKFQSVRIJ-LLVKDONJSA-N |
| XLogP | 1.58 |
| TPSA | 77.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.81 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |