C17H18ClNO6S2 — CID 72718927
1-(5-chloro-2-methoxyphenyl)sulfonyl-3-(4-methoxyphenyl)sulfonylazetidine (PubChem CID 72718927) has the molecular formula C17H18ClNO6S2 and a molecular weight of 431.92 g/mol. Its IUPAC name is 1-(5-chloro-2-methoxyphenyl)sulfonyl-3-(4-methoxyphenyl)sulfonylazetidine.
| Compound Name | 1-(5-chloro-2-methoxyphenyl)sulfonyl-3-(4-methoxyphenyl)sulfonylazetidine |
|---|---|
| PubChem CID | 72718927 |
| Molecular Formula | C17H18ClNO6S2 |
| Molecular Weight | 431.92 g/mol |
| Exact Mass | 431.03 |
| IUPAC Name | 1-(5-chloro-2-methoxyphenyl)sulfonyl-3-(4-methoxyphenyl)sulfonylazetidine |
| SMILES | COc1ccc(S(=O)(=O)C2CN(S(=O)(=O)c3cc(Cl)ccc3OC)C2)cc1 |
| InChI | InChI=1S/C17H18ClNO6S2/c1-24-13-4-6-14(7-5-13)26(20,21)15-10-19(11-15)27(22,23)17-9-12(18)3-8-16(17)25-2/h3-9,15H,10-11H2,1-2H3 |
| InChIKey | PSQQIUFNWRJXSP-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 89.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.92 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |