C17H18ClNO5S2 — CID 90593644
1-(5-chloro-2-methylphenyl)sulfonyl-3-(4-methoxyphenyl)sulfonylazetidine (PubChem CID 90593644) has the molecular formula C17H18ClNO5S2 and a molecular weight of 415.92 g/mol. Its IUPAC name is 1-(5-chloro-2-methylphenyl)sulfonyl-3-(4-methoxyphenyl)sulfonylazetidine.
| Compound Name | 1-(5-chloro-2-methylphenyl)sulfonyl-3-(4-methoxyphenyl)sulfonylazetidine |
|---|---|
| PubChem CID | 90593644 |
| Molecular Formula | C17H18ClNO5S2 |
| Molecular Weight | 415.92 g/mol |
| Exact Mass | 415.03 |
| IUPAC Name | 1-(5-chloro-2-methylphenyl)sulfonyl-3-(4-methoxyphenyl)sulfonylazetidine |
| SMILES | COc1ccc(S(=O)(=O)C2CN(S(=O)(=O)c3cc(Cl)ccc3C)C2)cc1 |
| InChI | InChI=1S/C17H18ClNO5S2/c1-12-3-4-13(18)9-17(12)26(22,23)19-10-16(11-19)25(20,21)15-7-5-14(24-2)6-8-15/h3-9,16H,10-11H2,1-2H3 |
| InChIKey | VGGVSESTSLYFHG-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 80.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.92 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |