C21H30ClN2O3S+ — CID 7290357
1-(1-adamantyl)-4-(5-chloro-2-methoxyphenyl)sulfonylpiperazin-1-ium (PubChem CID 7290357) has the molecular formula C21H30ClN2O3S+ and a molecular weight of 426.00 g/mol. Its IUPAC name is 1-(1-adamantyl)-4-(5-chloro-2-methoxyphenyl)sulfonylpiperazin-1-ium.
| Compound Name | 1-(1-adamantyl)-4-(5-chloro-2-methoxyphenyl)sulfonylpiperazin-1-ium |
|---|---|
| PubChem CID | 7290357 |
| Molecular Formula | C21H30ClN2O3S+ |
| Molecular Weight | 426.00 g/mol |
| Exact Mass | 425.17 |
| IUPAC Name | 1-(1-adamantyl)-4-(5-chloro-2-methoxyphenyl)sulfonylpiperazin-1-ium |
| SMILES | COc1ccc(Cl)cc1S(=O)(=O)N1CC[NH+](C23CC4CC(CC(C4)C2)C3)CC1 |
| InChI | InChI=1S/C21H29ClN2O3S/c1-27-19-3-2-18(22)11-20(19)28(25,26)24-6-4-23(5-7-24)21-12-15-8-16(13-21)10-17(9-15)14-21/h2-3,11,15-17H,4-10,12-14H2,1H3/p+1 |
| InChIKey | DUKKLCXROMDWSL-UHFFFAOYSA-O |
| XLogP | 2.21 |
| TPSA | 51.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.00 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |