C16H20ClNO5S — CID 129479758
methyl (2S)-6-(5-chloro-2-methoxyphenyl)sulfonyl-6-azaspiro[2.5]octane-2-carboxylate (PubChem CID 129479758) has the molecular formula C16H20ClNO5S and a molecular weight of 373.86 g/mol. Its IUPAC name is methyl (2S)-6-(5-chloro-2-methoxyphenyl)sulfonyl-6-azaspiro[2.5]octane-2-carboxylate.
| Compound Name | methyl (2S)-6-(5-chloro-2-methoxyphenyl)sulfonyl-6-azaspiro[2.5]octane-2-carboxylate |
|---|---|
| PubChem CID | 129479758 |
| Molecular Formula | C16H20ClNO5S |
| Molecular Weight | 373.86 g/mol |
| Exact Mass | 373.08 |
| IUPAC Name | methyl (2S)-6-(5-chloro-2-methoxyphenyl)sulfonyl-6-azaspiro[2.5]octane-2-carboxylate |
| SMILES | COC(=O)[C@H]1CC12CCN(S(=O)(=O)c1cc(Cl)ccc1OC)CC2 |
| InChI | InChI=1S/C16H20ClNO5S/c1-22-13-4-3-11(17)9-14(13)24(20,21)18-7-5-16(6-8-18)10-12(16)15(19)23-2/h3-4,9,12H,5-8,10H2,1-2H3/t12-/m1/s1 |
| InChIKey | IDLVXNGDJGHRSP-GFCCVEGCSA-N |
| XLogP | 2.31 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.86 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |