C19H23ClN2O5S — CID 3496187
1-(5-chloro-2-methoxyphenyl)-4-(2,5-dimethoxyphenyl)sulfonylpiperazine (PubChem CID 3496187) has the molecular formula C19H23ClN2O5S and a molecular weight of 426.92 g/mol. Its IUPAC name is 1-(5-chloro-2-methoxyphenyl)-4-(2,5-dimethoxyphenyl)sulfonylpiperazine.
| Compound Name | 1-(5-chloro-2-methoxyphenyl)-4-(2,5-dimethoxyphenyl)sulfonylpiperazine |
|---|---|
| PubChem CID | 3496187 |
| Molecular Formula | C19H23ClN2O5S |
| Molecular Weight | 426.92 g/mol |
| Exact Mass | 426.10 |
| IUPAC Name | 1-(5-chloro-2-methoxyphenyl)-4-(2,5-dimethoxyphenyl)sulfonylpiperazine |
| SMILES | COc1ccc(OC)c(S(=O)(=O)N2CCN(c3cc(Cl)ccc3OC)CC2)c1 |
| InChI | InChI=1S/C19H23ClN2O5S/c1-25-15-5-7-18(27-3)19(13-15)28(23,24)22-10-8-21(9-11-22)16-12-14(20)4-6-17(16)26-2/h4-7,12-13H,8-11H2,1-3H3 |
| InChIKey | OMFXFFAHMPWCHI-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 68.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.92 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |