C13H20N2O5S — CID 114398431
[4-(2,5-dimethoxyphenyl)sulfonylmorpholin-2-yl]methanamine (PubChem CID 114398431) has the molecular formula C13H20N2O5S and a molecular weight of 316.38 g/mol. Its IUPAC name is [4-(2,5-dimethoxyphenyl)sulfonylmorpholin-2-yl]methanamine.
| Compound Name | [4-(2,5-dimethoxyphenyl)sulfonylmorpholin-2-yl]methanamine |
|---|---|
| PubChem CID | 114398431 |
| Molecular Formula | C13H20N2O5S |
| Molecular Weight | 316.38 g/mol |
| Exact Mass | 316.11 |
| IUPAC Name | [4-(2,5-dimethoxyphenyl)sulfonylmorpholin-2-yl]methanamine |
| SMILES | COc1ccc(OC)c(S(=O)(=O)N2CCOC(CN)C2)c1 |
| InChI | InChI=1S/C13H20N2O5S/c1-18-10-3-4-12(19-2)13(7-10)21(16,17)15-5-6-20-11(8-14)9-15/h3-4,7,11H,5-6,8-9,14H2,1-2H3 |
| InChIKey | OTMGPCAMBQGOMQ-UHFFFAOYSA-N |
| XLogP | 0.05 |
| TPSA | 91.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.38 |
| LogP ≤ 5 | 0.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |