C20H25NO5S — CID 110364059
4-(2,5-dimethoxyphenyl)sulfonyl-2-(4-ethylphenyl)morpholine (PubChem CID 110364059) has the molecular formula C20H25NO5S and a molecular weight of 391.49 g/mol. Its IUPAC name is 4-(2,5-dimethoxyphenyl)sulfonyl-2-(4-ethylphenyl)morpholine.
| Compound Name | 4-(2,5-dimethoxyphenyl)sulfonyl-2-(4-ethylphenyl)morpholine |
|---|---|
| PubChem CID | 110364059 |
| Molecular Formula | C20H25NO5S |
| Molecular Weight | 391.49 g/mol |
| Exact Mass | 391.15 |
| IUPAC Name | 4-(2,5-dimethoxyphenyl)sulfonyl-2-(4-ethylphenyl)morpholine |
| SMILES | CCc1ccc(C2CN(S(=O)(=O)c3cc(OC)ccc3OC)CCO2)cc1 |
| InChI | InChI=1S/C20H25NO5S/c1-4-15-5-7-16(8-6-15)19-14-21(11-12-26-19)27(22,23)20-13-17(24-2)9-10-18(20)25-3/h5-10,13,19H,4,11-12,14H2,1-3H3 |
| InChIKey | ZYWFGGTYDCOBCL-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.49 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |