C18H20FNO5S — CID 110326792
4-(2,5-dimethoxyphenyl)sulfonyl-2-(4-fluorophenyl)morpholine (PubChem CID 110326792) has the molecular formula C18H20FNO5S and a molecular weight of 381.43 g/mol. Its IUPAC name is 4-(2,5-dimethoxyphenyl)sulfonyl-2-(4-fluorophenyl)morpholine.
| Compound Name | 4-(2,5-dimethoxyphenyl)sulfonyl-2-(4-fluorophenyl)morpholine |
|---|---|
| PubChem CID | 110326792 |
| Molecular Formula | C18H20FNO5S |
| Molecular Weight | 381.43 g/mol |
| Exact Mass | 381.10 |
| IUPAC Name | 4-(2,5-dimethoxyphenyl)sulfonyl-2-(4-fluorophenyl)morpholine |
| SMILES | COc1ccc(OC)c(S(=O)(=O)N2CCOC(c3ccc(F)cc3)C2)c1 |
| InChI | InChI=1S/C18H20FNO5S/c1-23-15-7-8-16(24-2)18(11-15)26(21,22)20-9-10-25-17(12-20)13-3-5-14(19)6-4-13/h3-8,11,17H,9-10,12H2,1-2H3 |
| InChIKey | LSXCRFWJRGBFKS-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.43 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |