C12H17ClN2O4S — CID 114398495
[4-(3-chloro-4-methoxyphenyl)sulfonylmorpholin-2-yl]methanamine (PubChem CID 114398495) has the molecular formula C12H17ClN2O4S and a molecular weight of 320.80 g/mol. Its IUPAC name is [4-(3-chloro-4-methoxyphenyl)sulfonylmorpholin-2-yl]methanamine.
| Compound Name | [4-(3-chloro-4-methoxyphenyl)sulfonylmorpholin-2-yl]methanamine |
|---|---|
| PubChem CID | 114398495 |
| Molecular Formula | C12H17ClN2O4S |
| Molecular Weight | 320.80 g/mol |
| Exact Mass | 320.06 |
| IUPAC Name | [4-(3-chloro-4-methoxyphenyl)sulfonylmorpholin-2-yl]methanamine |
| SMILES | COc1ccc(S(=O)(=O)N2CCOC(CN)C2)cc1Cl |
| InChI | InChI=1S/C12H17ClN2O4S/c1-18-12-3-2-10(6-11(12)13)20(16,17)15-4-5-19-9(7-14)8-15/h2-3,6,9H,4-5,7-8,14H2,1H3 |
| InChIKey | CISDASHUSGIHNQ-UHFFFAOYSA-N |
| XLogP | 0.70 |
| TPSA | 81.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.80 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |