C18H20ClNO5S — CID 110326908
2-(2-chlorophenyl)-4-(3,4-dimethoxyphenyl)sulfonylmorpholine (PubChem CID 110326908) has the molecular formula C18H20ClNO5S and a molecular weight of 397.88 g/mol. Its IUPAC name is 2-(2-chlorophenyl)-4-(3,4-dimethoxyphenyl)sulfonylmorpholine.
| Compound Name | 2-(2-chlorophenyl)-4-(3,4-dimethoxyphenyl)sulfonylmorpholine |
|---|---|
| PubChem CID | 110326908 |
| Molecular Formula | C18H20ClNO5S |
| Molecular Weight | 397.88 g/mol |
| Exact Mass | 397.08 |
| IUPAC Name | 2-(2-chlorophenyl)-4-(3,4-dimethoxyphenyl)sulfonylmorpholine |
| SMILES | COc1ccc(S(=O)(=O)N2CCOC(c3ccccc3Cl)C2)cc1OC |
| InChI | InChI=1S/C18H20ClNO5S/c1-23-16-8-7-13(11-17(16)24-2)26(21,22)20-9-10-25-18(12-20)14-5-3-4-6-15(14)19/h3-8,11,18H,9-10,12H2,1-2H3 |
| InChIKey | OWGNLSBYKDCZEV-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.88 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |