C19H23NO5S — CID 7353221
(2S,3R)-4-(3,4-dimethoxyphenyl)sulfonyl-3-methyl-2-phenylmorpholine (PubChem CID 7353221) has the molecular formula C19H23NO5S and a molecular weight of 377.46 g/mol. Its IUPAC name is (2S,3R)-4-(3,4-dimethoxyphenyl)sulfonyl-3-methyl-2-phenylmorpholine.
| Compound Name | (2S,3R)-4-(3,4-dimethoxyphenyl)sulfonyl-3-methyl-2-phenylmorpholine |
|---|---|
| PubChem CID | 7353221 |
| Molecular Formula | C19H23NO5S |
| Molecular Weight | 377.46 g/mol |
| Exact Mass | 377.13 |
| IUPAC Name | (2S,3R)-4-(3,4-dimethoxyphenyl)sulfonyl-3-methyl-2-phenylmorpholine |
| SMILES | COc1ccc(S(=O)(=O)N2CCO[C@@H](c3ccccc3)[C@H]2C)cc1OC |
| InChI | InChI=1S/C19H23NO5S/c1-14-19(15-7-5-4-6-8-15)25-12-11-20(14)26(21,22)16-9-10-17(23-2)18(13-16)24-3/h4-10,13-14,19H,11-12H2,1-3H3/t14-,19-/m1/s1 |
| InChIKey | HYFKLXRWAOTCQV-AUUYWEPGSA-N |
| XLogP | 2.85 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.46 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |