C13H16ClNO5S — CID 7111818
4-[3-chloro-4-[[(2S)-oxiran-2-yl]methoxy]phenyl]sulfonylmorpholine (PubChem CID 7111818) has the molecular formula C13H16ClNO5S and a molecular weight of 333.79 g/mol. Its IUPAC name is 4-[3-chloro-4-[[(2S)-oxiran-2-yl]methoxy]phenyl]sulfonylmorpholine.
| Compound Name | 4-[3-chloro-4-[[(2S)-oxiran-2-yl]methoxy]phenyl]sulfonylmorpholine |
|---|---|
| PubChem CID | 7111818 |
| Molecular Formula | C13H16ClNO5S |
| Molecular Weight | 333.79 g/mol |
| Exact Mass | 333.04 |
| IUPAC Name | 4-[3-chloro-4-[[(2S)-oxiran-2-yl]methoxy]phenyl]sulfonylmorpholine |
| SMILES | O=S(=O)(c1ccc(OC[C@@H]2CO2)c(Cl)c1)N1CCOCC1 |
| InChI | InChI=1S/C13H16ClNO5S/c14-12-7-11(1-2-13(12)20-9-10-8-19-10)21(16,17)15-3-5-18-6-4-15/h1-2,7,10H,3-6,8-9H2/t10-/m0/s1 |
| InChIKey | KBHVUJGCZXFVTR-JTQLQIEISA-N |
| XLogP | 1.14 |
| TPSA | 68.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.79 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|