C16H15Cl2NO5S2 — CID 2490622
2-(2-chloro-4-morpholin-4-ylsulfonylphenoxy)-1-(5-chlorothiophen-2-yl)ethanone (PubChem CID 2490622) has the molecular formula C16H15Cl2NO5S2 and a molecular weight of 436.34 g/mol. Its IUPAC name is 2-(2-chloro-4-morpholin-4-ylsulfonylphenoxy)-1-(5-chlorothiophen-2-yl)ethanone.
| Compound Name | 2-(2-chloro-4-morpholin-4-ylsulfonylphenoxy)-1-(5-chlorothiophen-2-yl)ethanone |
|---|---|
| PubChem CID | 2490622 |
| Molecular Formula | C16H15Cl2NO5S2 |
| Molecular Weight | 436.34 g/mol |
| Exact Mass | 434.98 |
| IUPAC Name | 2-(2-chloro-4-morpholin-4-ylsulfonylphenoxy)-1-(5-chlorothiophen-2-yl)ethanone |
| SMILES | O=C(COc1ccc(S(=O)(=O)N2CCOCC2)cc1Cl)c1ccc(Cl)s1 |
| InChI | InChI=1S/C16H15Cl2NO5S2/c17-12-9-11(26(21,22)19-5-7-23-8-6-19)1-2-14(12)24-10-13(20)15-3-4-16(18)25-15/h1-4,9H,5-8,10H2 |
| InChIKey | ZHCFZDLMDIGDSN-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.34 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |