C12H13ClNO6S- — CID 7457826
2-(2-chloro-4-morpholin-4-ylsulfonylphenoxy)acetate (PubChem CID 7457826) has the molecular formula C12H13ClNO6S- and a molecular weight of 334.76 g/mol. Its IUPAC name is 2-(2-chloro-4-morpholin-4-ylsulfonylphenoxy)acetate.
| Compound Name | 2-(2-chloro-4-morpholin-4-ylsulfonylphenoxy)acetate |
|---|---|
| PubChem CID | 7457826 |
| Molecular Formula | C12H13ClNO6S- |
| Molecular Weight | 334.76 g/mol |
| Exact Mass | 334.02 |
| IUPAC Name | 2-(2-chloro-4-morpholin-4-ylsulfonylphenoxy)acetate |
| SMILES | O=C([O-])COc1ccc(S(=O)(=O)N2CCOCC2)cc1Cl |
| InChI | InChI=1S/C12H14ClNO6S/c13-10-7-9(1-2-11(10)20-8-12(15)16)21(17,18)14-3-5-19-6-4-14/h1-2,7H,3-6,8H2,(H,15,16)/p-1 |
| InChIKey | SDMLJQHIDCXMJK-UHFFFAOYSA-M |
| XLogP | -0.51 |
| TPSA | 95.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.76 |
| LogP ≤ 5 | -0.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |