C16H23ClN2O5S — CID 7440472
(2R)-1-(2-chloro-4-morpholin-4-ylsulfonylphenoxy)-3-(cyclopropylamino)propan-2-ol (PubChem CID 7440472) has the molecular formula C16H23ClN2O5S and a molecular weight of 390.89 g/mol. Its IUPAC name is (2R)-1-(2-chloro-4-morpholin-4-ylsulfonylphenoxy)-3-(cyclopropylamino)propan-2-ol.
| Compound Name | (2R)-1-(2-chloro-4-morpholin-4-ylsulfonylphenoxy)-3-(cyclopropylamino)propan-2-ol |
|---|---|
| PubChem CID | 7440472 |
| Molecular Formula | C16H23ClN2O5S |
| Molecular Weight | 390.89 g/mol |
| Exact Mass | 390.10 |
| IUPAC Name | (2R)-1-(2-chloro-4-morpholin-4-ylsulfonylphenoxy)-3-(cyclopropylamino)propan-2-ol |
| SMILES | O=S(=O)(c1ccc(OC[C@H](O)CNC2CC2)c(Cl)c1)N1CCOCC1 |
| InChI | InChI=1S/C16H23ClN2O5S/c17-15-9-14(25(21,22)19-5-7-23-8-6-19)3-4-16(15)24-11-13(20)10-18-12-1-2-12/h3-4,9,12-13,18,20H,1-2,5-8,10-11H2/t13-/m1/s1 |
| InChIKey | BTXDPRHXFSGNSR-CYBMUJFWSA-N |
| XLogP | 0.85 |
| TPSA | 88.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.89 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |