C13H17Cl2NO2 — CID 62413983
1-(cyclobutylamino)-3-(2,4-dichlorophenoxy)propan-2-ol (PubChem CID 62413983) has the molecular formula C13H17Cl2NO2 and a molecular weight of 290.19 g/mol. Its IUPAC name is 1-(cyclobutylamino)-3-(2,4-dichlorophenoxy)propan-2-ol.
| Compound Name | 1-(cyclobutylamino)-3-(2,4-dichlorophenoxy)propan-2-ol |
|---|---|
| PubChem CID | 62413983 |
| Molecular Formula | C13H17Cl2NO2 |
| Molecular Weight | 290.19 g/mol |
| Exact Mass | 289.06 |
| IUPAC Name | 1-(cyclobutylamino)-3-(2,4-dichlorophenoxy)propan-2-ol |
| SMILES | OC(CNC1CCC1)COc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C13H17Cl2NO2/c14-9-4-5-13(12(15)6-9)18-8-11(17)7-16-10-2-1-3-10/h4-6,10-11,16-17H,1-3,7-8H2 |
| InChIKey | NQMUUKURJDTLBZ-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.19 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |