C23H33ClN2O5S — CID 3409221
1-(1-adamantylamino)-3-(2-chloro-4-morpholin-4-ylsulfonylphenoxy)propan-2-ol (PubChem CID 3409221) has the molecular formula C23H33ClN2O5S and a molecular weight of 485.05 g/mol. Its IUPAC name is 1-(1-adamantylamino)-3-(2-chloro-4-morpholin-4-ylsulfonylphenoxy)propan-2-ol.
| Compound Name | 1-(1-adamantylamino)-3-(2-chloro-4-morpholin-4-ylsulfonylphenoxy)propan-2-ol |
|---|---|
| PubChem CID | 3409221 |
| Molecular Formula | C23H33ClN2O5S |
| Molecular Weight | 485.05 g/mol |
| Exact Mass | 484.18 |
| IUPAC Name | 1-(1-adamantylamino)-3-(2-chloro-4-morpholin-4-ylsulfonylphenoxy)propan-2-ol |
| SMILES | O=S(=O)(c1ccc(OCC(O)CNC23CC4CC(CC(C4)C2)C3)c(Cl)c1)N1CCOCC1 |
| InChI | InChI=1S/C23H33ClN2O5S/c24-21-10-20(32(28,29)26-3-5-30-6-4-26)1-2-22(21)31-15-19(27)14-25-23-11-16-7-17(12-23)9-18(8-16)13-23/h1-2,10,16-19,25,27H,3-9,11-15H2 |
| InChIKey | QCMZFCTUSGZVHX-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 88.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.05 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |