C18H23ClN2O6S — CID 2409096
(2R)-1-(2-chloro-4-morpholin-4-ylsulfonylphenoxy)-3-(furan-2-ylmethylamino)propan-2-ol (PubChem CID 2409096) has the molecular formula C18H23ClN2O6S and a molecular weight of 430.91 g/mol. Its IUPAC name is (2R)-1-(2-chloro-4-morpholin-4-ylsulfonylphenoxy)-3-(furan-2-ylmethylamino)propan-2-ol.
| Compound Name | (2R)-1-(2-chloro-4-morpholin-4-ylsulfonylphenoxy)-3-(furan-2-ylmethylamino)propan-2-ol |
|---|---|
| PubChem CID | 2409096 |
| Molecular Formula | C18H23ClN2O6S |
| Molecular Weight | 430.91 g/mol |
| Exact Mass | 430.10 |
| IUPAC Name | (2R)-1-(2-chloro-4-morpholin-4-ylsulfonylphenoxy)-3-(furan-2-ylmethylamino)propan-2-ol |
| SMILES | O=S(=O)(c1ccc(OC[C@H](O)CNCc2ccco2)c(Cl)c1)N1CCOCC1 |
| InChI | InChI=1S/C18H23ClN2O6S/c19-17-10-16(28(23,24)21-5-8-25-9-6-21)3-4-18(17)27-13-14(22)11-20-12-15-2-1-7-26-15/h1-4,7,10,14,20,22H,5-6,8-9,11-13H2/t14-/m1/s1 |
| InChIKey | WGZVLJQLIGVFHQ-CQSZACIVSA-N |
| XLogP | 1.48 |
| TPSA | 101.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.91 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |