C20H27NO7 — CID 18593406
1-(furan-2-ylmethylamino)-3-(5-methyl-2-propan-2-ylphenoxy)propan-2-ol;oxalic acid (PubChem CID 18593406) has the molecular formula C20H27NO7 and a molecular weight of 393.44 g/mol. Its IUPAC name is 1-(furan-2-ylmethylamino)-3-(5-methyl-2-propan-2-ylphenoxy)propan-2-ol;oxalic acid.
| Compound Name | 1-(furan-2-ylmethylamino)-3-(5-methyl-2-propan-2-ylphenoxy)propan-2-ol;oxalic acid |
|---|---|
| PubChem CID | 18593406 |
| Molecular Formula | C20H27NO7 |
| Molecular Weight | 393.44 g/mol |
| Exact Mass | 393.18 |
| IUPAC Name | 1-(furan-2-ylmethylamino)-3-(5-methyl-2-propan-2-ylphenoxy)propan-2-ol;oxalic acid |
| SMILES | Cc1ccc(C(C)C)c(OCC(O)CNCc2ccco2)c1.O=C(O)C(=O)O |
| InChI | InChI=1S/C18H25NO3.C2H2O4/c1-13(2)17-7-6-14(3)9-18(17)22-12-15(20)10-19-11-16-5-4-8-21-16;3-1(4)2(5)6/h4-9,13,15,19-20H,10-12H2,1-3H3;(H,3,4)(H,5,6) |
| InChIKey | XCQSZSGXQVAAIK-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 129.23 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.44 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|