C17H27NO7 — CID 18593413
1-(2-hydroxyethylamino)-3-(5-methyl-2-propan-2-ylphenoxy)propan-2-ol;oxalic acid (PubChem CID 18593413) has the molecular formula C17H27NO7 and a molecular weight of 357.40 g/mol. Its IUPAC name is 1-(2-hydroxyethylamino)-3-(5-methyl-2-propan-2-ylphenoxy)propan-2-ol;oxalic acid.
| Compound Name | 1-(2-hydroxyethylamino)-3-(5-methyl-2-propan-2-ylphenoxy)propan-2-ol;oxalic acid |
|---|---|
| PubChem CID | 18593413 |
| Molecular Formula | C17H27NO7 |
| Molecular Weight | 357.40 g/mol |
| Exact Mass | 357.18 |
| IUPAC Name | 1-(2-hydroxyethylamino)-3-(5-methyl-2-propan-2-ylphenoxy)propan-2-ol;oxalic acid |
| SMILES | Cc1ccc(C(C)C)c(OCC(O)CNCCO)c1.O=C(O)C(=O)O |
| InChI | InChI=1S/C15H25NO3.C2H2O4/c1-11(2)14-5-4-12(3)8-15(14)19-10-13(18)9-16-6-7-17;3-1(4)2(5)6/h4-5,8,11,13,16-18H,6-7,9-10H2,1-3H3;(H,3,4)(H,5,6) |
| InChIKey | OPHSNSVZVKWVGH-UHFFFAOYSA-N |
| XLogP | 0.60 |
| TPSA | 136.32 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.40 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|