C18H19NO3 — CID 7223566
(2R)-1-(furan-2-ylmethylamino)-3-naphthalen-2-yloxypropan-2-ol (PubChem CID 7223566) has the molecular formula C18H19NO3 and a molecular weight of 297.35 g/mol. Its IUPAC name is (2R)-1-(furan-2-ylmethylamino)-3-naphthalen-2-yloxypropan-2-ol.
| Compound Name | (2R)-1-(furan-2-ylmethylamino)-3-naphthalen-2-yloxypropan-2-ol |
|---|---|
| PubChem CID | 7223566 |
| Molecular Formula | C18H19NO3 |
| Molecular Weight | 297.35 g/mol |
| Exact Mass | 297.14 |
| IUPAC Name | (2R)-1-(furan-2-ylmethylamino)-3-naphthalen-2-yloxypropan-2-ol |
| SMILES | O[C@H](CNCc1ccco1)COc1ccc2ccccc2c1 |
| InChI | InChI=1S/C18H19NO3/c20-16(11-19-12-18-6-3-9-21-18)13-22-17-8-7-14-4-1-2-5-15(14)10-17/h1-10,16,19-20H,11-13H2/t16-/m1/s1 |
| InChIKey | ONLCCCNLNUIMPR-MRXNPFEDSA-N |
| XLogP | 2.96 |
| TPSA | 54.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.35 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |