C18H21NO3S2 — CID 90632669
(2,4-dimethoxyphenyl)-(7-thiophen-2-yl-1,4-thiazepan-4-yl)methanone (PubChem CID 90632669) has the molecular formula C18H21NO3S2 and a molecular weight of 363.50 g/mol. Its IUPAC name is (2,4-dimethoxyphenyl)-(7-thiophen-2-yl-1,4-thiazepan-4-yl)methanone.
| Compound Name | (2,4-dimethoxyphenyl)-(7-thiophen-2-yl-1,4-thiazepan-4-yl)methanone |
|---|---|
| PubChem CID | 90632669 |
| Molecular Formula | C18H21NO3S2 |
| Molecular Weight | 363.50 g/mol |
| Exact Mass | 363.10 |
| IUPAC Name | (2,4-dimethoxyphenyl)-(7-thiophen-2-yl-1,4-thiazepan-4-yl)methanone |
| SMILES | COc1ccc(C(=O)N2CCSC(c3cccs3)CC2)c(OC)c1 |
| InChI | InChI=1S/C18H21NO3S2/c1-21-13-5-6-14(15(12-13)22-2)18(20)19-8-7-17(24-11-9-19)16-4-3-10-23-16/h3-6,10,12,17H,7-9,11H2,1-2H3 |
| InChIKey | QGAZBSJMTCWPRN-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.50 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |