C20H23NO5S — CID 90589371
[4-(benzenesulfonyl)piperidin-1-yl]-(2,4-dimethoxyphenyl)methanone (PubChem CID 90589371) has the molecular formula C20H23NO5S and a molecular weight of 389.47 g/mol. Its IUPAC name is [4-(benzenesulfonyl)piperidin-1-yl]-(2,4-dimethoxyphenyl)methanone.
| Compound Name | [4-(benzenesulfonyl)piperidin-1-yl]-(2,4-dimethoxyphenyl)methanone |
|---|---|
| PubChem CID | 90589371 |
| Molecular Formula | C20H23NO5S |
| Molecular Weight | 389.47 g/mol |
| Exact Mass | 389.13 |
| IUPAC Name | [4-(benzenesulfonyl)piperidin-1-yl]-(2,4-dimethoxyphenyl)methanone |
| SMILES | COc1ccc(C(=O)N2CCC(S(=O)(=O)c3ccccc3)CC2)c(OC)c1 |
| InChI | InChI=1S/C20H23NO5S/c1-25-15-8-9-18(19(14-15)26-2)20(22)21-12-10-17(11-13-21)27(23,24)16-6-4-3-5-7-16/h3-9,14,17H,10-13H2,1-2H3 |
| InChIKey | FCAHMMOBOOUDMQ-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.47 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |