C21H26N2O6S — CID 90589401
4-(benzenesulfonyl)-N-(3,4,5-trimethoxyphenyl)piperidine-1-carboxamide (PubChem CID 90589401) has the molecular formula C21H26N2O6S and a molecular weight of 434.51 g/mol. Its IUPAC name is 4-(benzenesulfonyl)-N-(3,4,5-trimethoxyphenyl)piperidine-1-carboxamide.
| Compound Name | 4-(benzenesulfonyl)-N-(3,4,5-trimethoxyphenyl)piperidine-1-carboxamide |
|---|---|
| PubChem CID | 90589401 |
| Molecular Formula | C21H26N2O6S |
| Molecular Weight | 434.51 g/mol |
| Exact Mass | 434.15 |
| IUPAC Name | 4-(benzenesulfonyl)-N-(3,4,5-trimethoxyphenyl)piperidine-1-carboxamide |
| SMILES | COc1cc(NC(=O)N2CCC(S(=O)(=O)c3ccccc3)CC2)cc(OC)c1OC |
| InChI | InChI=1S/C21H26N2O6S/c1-27-18-13-15(14-19(28-2)20(18)29-3)22-21(24)23-11-9-17(10-12-23)30(25,26)16-7-5-4-6-8-16/h4-8,13-14,17H,9-12H2,1-3H3,(H,22,24) |
| InChIKey | MDXUJPNQTAORAU-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 94.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.51 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |