C12H15IN2O3S — CID 143541768
4-(benzenesulfonyl)-N-iodopiperidine-1-carboxamide (PubChem CID 143541768) has the molecular formula C12H15IN2O3S and a molecular weight of 394.23 g/mol. Its IUPAC name is 4-(benzenesulfonyl)-N-iodopiperidine-1-carboxamide.
| Compound Name | 4-(benzenesulfonyl)-N-iodopiperidine-1-carboxamide |
|---|---|
| PubChem CID | 143541768 |
| Molecular Formula | C12H15IN2O3S |
| Molecular Weight | 394.23 g/mol |
| Exact Mass | 393.98 |
| IUPAC Name | 4-(benzenesulfonyl)-N-iodopiperidine-1-carboxamide |
| SMILES | O=C(NI)N1CCC(S(=O)(=O)c2ccccc2)CC1 |
| InChI | InChI=1S/C12H15IN2O3S/c13-14-12(16)15-8-6-11(7-9-15)19(17,18)10-4-2-1-3-5-10/h1-5,11H,6-9H2,(H,14,16) |
| InChIKey | PKIUYXPMSGCFRO-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.23 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|