C17H25NO3S — CID 90589120
1-[4-(benzenesulfonyl)piperidin-1-yl]-3,3-dimethylbutan-1-one (PubChem CID 90589120) has the molecular formula C17H25NO3S and a molecular weight of 323.46 g/mol. Its IUPAC name is 1-[4-(benzenesulfonyl)piperidin-1-yl]-3,3-dimethylbutan-1-one.
| Compound Name | 1-[4-(benzenesulfonyl)piperidin-1-yl]-3,3-dimethylbutan-1-one |
|---|---|
| PubChem CID | 90589120 |
| Molecular Formula | C17H25NO3S |
| Molecular Weight | 323.46 g/mol |
| Exact Mass | 323.16 |
| IUPAC Name | 1-[4-(benzenesulfonyl)piperidin-1-yl]-3,3-dimethylbutan-1-one |
| SMILES | CC(C)(C)CC(=O)N1CCC(S(=O)(=O)c2ccccc2)CC1 |
| InChI | InChI=1S/C17H25NO3S/c1-17(2,3)13-16(19)18-11-9-15(10-12-18)22(20,21)14-7-5-4-6-8-14/h4-8,15H,9-13H2,1-3H3 |
| InChIKey | ZPZOLVOSKYHZFW-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.46 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |