C26H27NO5S — CID 90591858
1-[4-(4-methoxyphenyl)sulfonylpiperidin-1-yl]-2-(4-phenylphenoxy)ethanone (PubChem CID 90591858) has the molecular formula C26H27NO5S and a molecular weight of 465.57 g/mol. Its IUPAC name is 1-[4-(4-methoxyphenyl)sulfonylpiperidin-1-yl]-2-(4-phenylphenoxy)ethanone.
| Compound Name | 1-[4-(4-methoxyphenyl)sulfonylpiperidin-1-yl]-2-(4-phenylphenoxy)ethanone |
|---|---|
| PubChem CID | 90591858 |
| Molecular Formula | C26H27NO5S |
| Molecular Weight | 465.57 g/mol |
| Exact Mass | 465.16 |
| IUPAC Name | 1-[4-(4-methoxyphenyl)sulfonylpiperidin-1-yl]-2-(4-phenylphenoxy)ethanone |
| SMILES | COc1ccc(S(=O)(=O)C2CCN(C(=O)COc3ccc(-c4ccccc4)cc3)CC2)cc1 |
| InChI | InChI=1S/C26H27NO5S/c1-31-22-11-13-24(14-12-22)33(29,30)25-15-17-27(18-16-25)26(28)19-32-23-9-7-21(8-10-23)20-5-3-2-4-6-20/h2-14,25H,15-19H2,1H3 |
| InChIKey | JZHMWTWQJNPILG-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.57 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |