C24H25NO4S — CID 90591931
1-[4-(4-methoxyphenyl)sulfonylpiperidin-1-yl]-2-naphthalen-1-ylethanone (PubChem CID 90591931) has the molecular formula C24H25NO4S and a molecular weight of 423.53 g/mol. Its IUPAC name is 1-[4-(4-methoxyphenyl)sulfonylpiperidin-1-yl]-2-naphthalen-1-ylethanone.
| Compound Name | 1-[4-(4-methoxyphenyl)sulfonylpiperidin-1-yl]-2-naphthalen-1-ylethanone |
|---|---|
| PubChem CID | 90591931 |
| Molecular Formula | C24H25NO4S |
| Molecular Weight | 423.53 g/mol |
| Exact Mass | 423.15 |
| IUPAC Name | 1-[4-(4-methoxyphenyl)sulfonylpiperidin-1-yl]-2-naphthalen-1-ylethanone |
| SMILES | COc1ccc(S(=O)(=O)C2CCN(C(=O)Cc3cccc4ccccc34)CC2)cc1 |
| InChI | InChI=1S/C24H25NO4S/c1-29-20-9-11-21(12-10-20)30(27,28)22-13-15-25(16-14-22)24(26)17-19-7-4-6-18-5-2-3-8-23(18)19/h2-12,22H,13-17H2,1H3 |
| InChIKey | DHBVBJYUKPYYSH-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.53 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |