C24H32N2O5S2 — CID 90589242
N-[3-[4-(benzenesulfonyl)piperidin-1-yl]-3-oxopropyl]-4-tert-butylbenzenesulfonamide (PubChem CID 90589242) has the molecular formula C24H32N2O5S2 and a molecular weight of 492.66 g/mol. Its IUPAC name is N-[3-[4-(benzenesulfonyl)piperidin-1-yl]-3-oxopropyl]-4-tert-butylbenzenesulfonamide.
| Compound Name | N-[3-[4-(benzenesulfonyl)piperidin-1-yl]-3-oxopropyl]-4-tert-butylbenzenesulfonamide |
|---|---|
| PubChem CID | 90589242 |
| Molecular Formula | C24H32N2O5S2 |
| Molecular Weight | 492.66 g/mol |
| Exact Mass | 492.18 |
| IUPAC Name | N-[3-[4-(benzenesulfonyl)piperidin-1-yl]-3-oxopropyl]-4-tert-butylbenzenesulfonamide |
| SMILES | CC(C)(C)c1ccc(S(=O)(=O)NCCC(=O)N2CCC(S(=O)(=O)c3ccccc3)CC2)cc1 |
| InChI | InChI=1S/C24H32N2O5S2/c1-24(2,3)19-9-11-22(12-10-19)33(30,31)25-16-13-23(27)26-17-14-21(15-18-26)32(28,29)20-7-5-4-6-8-20/h4-12,21,25H,13-18H2,1-3H3 |
| InChIKey | LNRRCSBKEDTRNW-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 100.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.66 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |