C21H31NO3S — CID 90584874
[3-(benzenesulfonyl)pyrrolidin-1-yl]-(4-butylcyclohexyl)methanone (PubChem CID 90584874) has the molecular formula C21H31NO3S and a molecular weight of 377.55 g/mol. Its IUPAC name is [3-(benzenesulfonyl)pyrrolidin-1-yl]-(4-butylcyclohexyl)methanone.
| Compound Name | [3-(benzenesulfonyl)pyrrolidin-1-yl]-(4-butylcyclohexyl)methanone |
|---|---|
| PubChem CID | 90584874 |
| Molecular Formula | C21H31NO3S |
| Molecular Weight | 377.55 g/mol |
| Exact Mass | 377.20 |
| IUPAC Name | [3-(benzenesulfonyl)pyrrolidin-1-yl]-(4-butylcyclohexyl)methanone |
| SMILES | CCCCC1CCC(C(=O)N2CCC(S(=O)(=O)c3ccccc3)C2)CC1 |
| InChI | InChI=1S/C21H31NO3S/c1-2-3-7-17-10-12-18(13-11-17)21(23)22-15-14-20(16-22)26(24,25)19-8-5-4-6-9-19/h4-6,8-9,17-18,20H,2-3,7,10-16H2,1H3 |
| InChIKey | CZASSXSSBKCYJC-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.55 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |